C30H27NO3 — CID 25101053
3-(2,3-dimethylphenyl)-1-(3-naphthalen-1-yloxypropyl)indole-2-carboxylic acid (PubChem CID 25101053) has the molecular formula C30H27NO3 and a molecular weight of 449.55 g/mol. Its IUPAC name is 3-(2,3-dimethylphenyl)-1-(3-naphthalen-1-yloxypropyl)indole-2-carboxylic acid.
| Compound Name | 3-(2,3-dimethylphenyl)-1-(3-naphthalen-1-yloxypropyl)indole-2-carboxylic acid |
|---|---|
| PubChem CID | 25101053 |
| Molecular Formula | C30H27NO3 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 3-(2,3-dimethylphenyl)-1-(3-naphthalen-1-yloxypropyl)indole-2-carboxylic acid |
| SMILES | Cc1cccc(-c2c(C(=O)O)n(CCCOc3cccc4ccccc34)c3ccccc23)c1C |
| InChI | InChI=1S/C30H27NO3/c1-20-10-7-15-23(21(20)2)28-25-14-5-6-16-26(25)31(29(28)30(32)33)18-9-19-34-27-17-8-12-22-11-3-4-13-24(22)27/h3-8,10-17H,9,18-19H2,1-2H3,(H,32,33) |
| InChIKey | BZNNXOPBWRNROS-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|