C39H44N2O5 — CID 67315499
5-(4-morpholin-4-ylbutoxy)-1-(3-naphthalen-1-yloxypropyl)-3-(2-propan-2-ylphenyl)indole-2-carboxylic acid (PubChem CID 67315499) has the molecular formula C39H44N2O5 and a molecular weight of 620.79 g/mol. Its IUPAC name is 5-(4-morpholin-4-ylbutoxy)-1-(3-naphthalen-1-yloxypropyl)-3-(2-propan-2-ylphenyl)indole-2-carboxylic acid.
| Compound Name | 5-(4-morpholin-4-ylbutoxy)-1-(3-naphthalen-1-yloxypropyl)-3-(2-propan-2-ylphenyl)indole-2-carboxylic acid |
|---|---|
| PubChem CID | 67315499 |
| Molecular Formula | C39H44N2O5 |
| Molecular Weight | 620.79 g/mol |
| Exact Mass | 620.33 |
| IUPAC Name | 5-(4-morpholin-4-ylbutoxy)-1-(3-naphthalen-1-yloxypropyl)-3-(2-propan-2-ylphenyl)indole-2-carboxylic acid |
| SMILES | CC(C)c1ccccc1-c1c(C(=O)O)n(CCCOc2cccc3ccccc23)c2ccc(OCCCCN3CCOCC3)cc12 |
| InChI | InChI=1S/C39H44N2O5/c1-28(2)31-13-5-6-15-33(31)37-34-27-30(45-23-8-7-19-40-21-25-44-26-22-40)17-18-35(34)41(38(37)39(42)43)20-10-24-46-36-16-9-12-29-11-3-4-14-32(29)36/h3-6,9,11-18,27-28H,7-8,10,19-26H2,1-2H3,(H,42,43) |
| InChIKey | PYBOBDDQNAXZHM-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.79 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|