C36H29F3N2O5 — CID 67316609
1-(3-naphthalen-1-yloxypropyl)-5-phenylmethoxy-3-[3-(trifluoromethoxy)anilino]indole-2-carboxylic acid (PubChem CID 67316609) has the molecular formula C36H29F3N2O5 and a molecular weight of 626.63 g/mol. Its IUPAC name is 1-(3-naphthalen-1-yloxypropyl)-5-phenylmethoxy-3-[3-(trifluoromethoxy)anilino]indole-2-carboxylic acid.
| Compound Name | 1-(3-naphthalen-1-yloxypropyl)-5-phenylmethoxy-3-[3-(trifluoromethoxy)anilino]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 67316609 |
| Molecular Formula | C36H29F3N2O5 |
| Molecular Weight | 626.63 g/mol |
| Exact Mass | 626.20 |
| IUPAC Name | 1-(3-naphthalen-1-yloxypropyl)-5-phenylmethoxy-3-[3-(trifluoromethoxy)anilino]indole-2-carboxylic acid |
| SMILES | O=C(O)c1c(Nc2cccc(OC(F)(F)F)c2)c2cc(OCc3ccccc3)ccc2n1CCCOc1cccc2ccccc12 |
| InChI | InChI=1S/C36H29F3N2O5/c37-36(38,39)46-28-14-7-13-26(21-28)40-33-30-22-27(45-23-24-9-2-1-3-10-24)17-18-31(30)41(34(33)35(42)43)19-8-20-44-32-16-6-12-25-11-4-5-15-29(25)32/h1-7,9-18,21-22,40H,8,19-20,23H2,(H,42,43) |
| InChIKey | YBSKSOUQRVUZPF-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.63 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|