C23H28FNO4 — CID 143750240
ethane;5-fluoro-1-(4-methoxybutyl)-3-phenylmethoxyindole-2-carboxylic acid (PubChem CID 143750240) has the molecular formula C23H28FNO4 and a molecular weight of 401.48 g/mol. Its IUPAC name is ethane;5-fluoro-1-(4-methoxybutyl)-3-phenylmethoxyindole-2-carboxylic acid.
| Compound Name | ethane;5-fluoro-1-(4-methoxybutyl)-3-phenylmethoxyindole-2-carboxylic acid |
|---|---|
| PubChem CID | 143750240 |
| Molecular Formula | C23H28FNO4 |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | ethane;5-fluoro-1-(4-methoxybutyl)-3-phenylmethoxyindole-2-carboxylic acid |
| SMILES | CC.COCCCCn1c(C(=O)O)c(OCc2ccccc2)c2cc(F)ccc21 |
| InChI | InChI=1S/C21H22FNO4.C2H6/c1-26-12-6-5-11-23-18-10-9-16(22)13-17(18)20(19(23)21(24)25)27-14-15-7-3-2-4-8-15;1-2/h2-4,7-10,13H,5-6,11-12,14H2,1H3,(H,24,25);1-2H3 |
| InChIKey | RJSXYZAPAVIKKA-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|