C29H40ClN3O3 — CID 25176175
1-(4-methoxybutyl)-3-phenylmethoxy-N-[(3R)-piperidin-3-yl]-N-propan-2-ylindole-2-carboxamide;hydrochloride (PubChem CID 25176175) has the molecular formula C29H40ClN3O3 and a molecular weight of 514.11 g/mol. Its IUPAC name is 1-(4-methoxybutyl)-3-phenylmethoxy-N-[(3R)-piperidin-3-yl]-N-propan-2-ylindole-2-carboxamide;hydrochloride.
| Compound Name | 1-(4-methoxybutyl)-3-phenylmethoxy-N-[(3R)-piperidin-3-yl]-N-propan-2-ylindole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 25176175 |
| Molecular Formula | C29H40ClN3O3 |
| Molecular Weight | 514.11 g/mol |
| Exact Mass | 513.28 |
| IUPAC Name | 1-(4-methoxybutyl)-3-phenylmethoxy-N-[(3R)-piperidin-3-yl]-N-propan-2-ylindole-2-carboxamide;hydrochloride |
| SMILES | COCCCCn1c(C(=O)N(C(C)C)[C@@H]2CCCNC2)c(OCc2ccccc2)c2ccccc21.Cl |
| InChI | InChI=1S/C29H39N3O3.ClH/c1-22(2)32(24-14-11-17-30-20-24)29(33)27-28(35-21-23-12-5-4-6-13-23)25-15-7-8-16-26(25)31(27)18-9-10-19-34-3;/h4-8,12-13,15-16,22,24,30H,9-11,14,17-21H2,1-3H3;1H/t24-;/m1./s1 |
| InChIKey | AWLSVZXVVVRZMF-GJFSDDNBSA-N |
| XLogP | 5.67 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.11 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|