C20H32N2O3 — CID 143814264
4-hydroxy-3-(4-methoxybutyl)-N-piperidin-3-yl-N-propan-2-ylbenzamide (PubChem CID 143814264) has the molecular formula C20H32N2O3 and a molecular weight of 348.49 g/mol. Its IUPAC name is 4-hydroxy-3-(4-methoxybutyl)-N-piperidin-3-yl-N-propan-2-ylbenzamide.
| Compound Name | 4-hydroxy-3-(4-methoxybutyl)-N-piperidin-3-yl-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 143814264 |
| Molecular Formula | C20H32N2O3 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | 4-hydroxy-3-(4-methoxybutyl)-N-piperidin-3-yl-N-propan-2-ylbenzamide |
| SMILES | COCCCCc1cc(C(=O)N(C(C)C)C2CCCNC2)ccc1O |
| InChI | InChI=1S/C20H32N2O3/c1-15(2)22(18-8-6-11-21-14-18)20(24)17-9-10-19(23)16(13-17)7-4-5-12-25-3/h9-10,13,15,18,21,23H,4-8,11-12,14H2,1-3H3 |
| InChIKey | SUCLQYDPIMBHNI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|