C25H40N2O4 — CID 59223919
4-cyclohexyloxy-3-(3-methoxypropoxy)-N-[(3R)-piperidin-3-yl]-N-propan-2-ylbenzamide (PubChem CID 59223919) has the molecular formula C25H40N2O4 and a molecular weight of 432.61 g/mol. Its IUPAC name is 4-cyclohexyloxy-3-(3-methoxypropoxy)-N-[(3R)-piperidin-3-yl]-N-propan-2-ylbenzamide.
| Compound Name | 4-cyclohexyloxy-3-(3-methoxypropoxy)-N-[(3R)-piperidin-3-yl]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 59223919 |
| Molecular Formula | C25H40N2O4 |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.30 |
| IUPAC Name | 4-cyclohexyloxy-3-(3-methoxypropoxy)-N-[(3R)-piperidin-3-yl]-N-propan-2-ylbenzamide |
| SMILES | COCCCOc1cc(C(=O)N(C(C)C)[C@@H]2CCCNC2)ccc1OC1CCCCC1 |
| InChI | InChI=1S/C25H40N2O4/c1-19(2)27(21-9-7-14-26-18-21)25(28)20-12-13-23(31-22-10-5-4-6-11-22)24(17-20)30-16-8-15-29-3/h12-13,17,19,21-22,26H,4-11,14-16,18H2,1-3H3/t21-/m1/s1 |
| InChIKey | CHLHPUBXFYDZTC-OAQYLSRUSA-N |
| XLogP | 4.42 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|