C25H32ClFN2O3 — CID 42634826
4-(3-chloro-2-fluorophenyl)-3-(3-methoxypropoxy)-N-piperidin-3-yl-N-propan-2-ylbenzamide (PubChem CID 42634826) has the molecular formula C25H32ClFN2O3 and a molecular weight of 462.99 g/mol. Its IUPAC name is 4-(3-chloro-2-fluorophenyl)-3-(3-methoxypropoxy)-N-piperidin-3-yl-N-propan-2-ylbenzamide.
| Compound Name | 4-(3-chloro-2-fluorophenyl)-3-(3-methoxypropoxy)-N-piperidin-3-yl-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 42634826 |
| Molecular Formula | C25H32ClFN2O3 |
| Molecular Weight | 462.99 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | 4-(3-chloro-2-fluorophenyl)-3-(3-methoxypropoxy)-N-piperidin-3-yl-N-propan-2-ylbenzamide |
| SMILES | COCCCOc1cc(C(=O)N(C(C)C)C2CCCNC2)ccc1-c1cccc(Cl)c1F |
| InChI | InChI=1S/C25H32ClFN2O3/c1-17(2)29(19-7-5-12-28-16-19)25(30)18-10-11-20(21-8-4-9-22(26)24(21)27)23(15-18)32-14-6-13-31-3/h4,8-11,15,17,19,28H,5-7,12-14,16H2,1-3H3 |
| InChIKey | FHRZUCOEARMCFE-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.99 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|