C26H36N2O4 — CID 59224193
3-(3-methoxypropoxy)-4-phenylmethoxy-N-[(3R)-piperidin-3-yl]-N-propan-2-ylbenzamide (PubChem CID 59224193) has the molecular formula C26H36N2O4 and a molecular weight of 440.58 g/mol. Its IUPAC name is 3-(3-methoxypropoxy)-4-phenylmethoxy-N-[(3R)-piperidin-3-yl]-N-propan-2-ylbenzamide.
| Compound Name | 3-(3-methoxypropoxy)-4-phenylmethoxy-N-[(3R)-piperidin-3-yl]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 59224193 |
| Molecular Formula | C26H36N2O4 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.27 |
| IUPAC Name | 3-(3-methoxypropoxy)-4-phenylmethoxy-N-[(3R)-piperidin-3-yl]-N-propan-2-ylbenzamide |
| SMILES | COCCCOc1cc(C(=O)N(C(C)C)[C@@H]2CCCNC2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C26H36N2O4/c1-20(2)28(23-11-7-14-27-18-23)26(29)22-12-13-24(25(17-22)31-16-8-15-30-3)32-19-21-9-5-4-6-10-21/h4-6,9-10,12-13,17,20,23,27H,7-8,11,14-16,18-19H2,1-3H3/t23-/m1/s1 |
| InChIKey | IXVCDGDYKQGQDI-HSZRJFAPSA-N |
| XLogP | 4.28 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|