C27H38N2O5 — CID 70910446
4-methoxy-3-(3-methoxypropoxy)-N-[5-(phenoxymethyl)piperidin-3-yl]-N-propan-2-ylbenzamide (PubChem CID 70910446) has the molecular formula C27H38N2O5 and a molecular weight of 470.61 g/mol. Its IUPAC name is 4-methoxy-3-(3-methoxypropoxy)-N-[5-(phenoxymethyl)piperidin-3-yl]-N-propan-2-ylbenzamide.
| Compound Name | 4-methoxy-3-(3-methoxypropoxy)-N-[5-(phenoxymethyl)piperidin-3-yl]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 70910446 |
| Molecular Formula | C27H38N2O5 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.28 |
| IUPAC Name | 4-methoxy-3-(3-methoxypropoxy)-N-[5-(phenoxymethyl)piperidin-3-yl]-N-propan-2-ylbenzamide |
| SMILES | COCCCOc1cc(C(=O)N(C(C)C)C2CNCC(COc3ccccc3)C2)ccc1OC |
| InChI | InChI=1S/C27H38N2O5/c1-20(2)29(23-15-21(17-28-18-23)19-34-24-9-6-5-7-10-24)27(30)22-11-12-25(32-4)26(16-22)33-14-8-13-31-3/h5-7,9-12,16,20-21,23,28H,8,13-15,17-19H2,1-4H3 |
| InChIKey | AVJWNPWLDMFTCT-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|