C30H43N3O6 — CID 68662170
[(3S,5R)-5-[[4-methoxy-3-(3-methoxypropoxy)benzoyl]-propan-2-ylamino]piperidin-3-yl]methyl-(2-phenylethyl)carbamic acid (PubChem CID 68662170) has the molecular formula C30H43N3O6 and a molecular weight of 541.69 g/mol. Its IUPAC name is [(3S,5R)-5-[[4-methoxy-3-(3-methoxypropoxy)benzoyl]-propan-2-ylamino]piperidin-3-yl]methyl-(2-phenylethyl)carbamic acid.
| Compound Name | [(3S,5R)-5-[[4-methoxy-3-(3-methoxypropoxy)benzoyl]-propan-2-ylamino]piperidin-3-yl]methyl-(2-phenylethyl)carbamic acid |
|---|---|
| PubChem CID | 68662170 |
| Molecular Formula | C30H43N3O6 |
| Molecular Weight | 541.69 g/mol |
| Exact Mass | 541.32 |
| IUPAC Name | [(3S,5R)-5-[[4-methoxy-3-(3-methoxypropoxy)benzoyl]-propan-2-ylamino]piperidin-3-yl]methyl-(2-phenylethyl)carbamic acid |
| SMILES | COCCCOc1cc(C(=O)N(C(C)C)[C@H]2CNC[C@@H](CN(CCc3ccccc3)C(=O)O)C2)ccc1OC |
| InChI | InChI=1S/C30H43N3O6/c1-22(2)33(29(34)25-11-12-27(38-4)28(18-25)39-16-8-15-37-3)26-17-24(19-31-20-26)21-32(30(35)36)14-13-23-9-6-5-7-10-23/h5-7,9-12,18,22,24,26,31H,8,13-17,19-21H2,1-4H3,(H,35,36)/t24-,26+/m0/s1 |
| InChIKey | REJIMQSWMHCTON-AZGAKELHSA-N |
| XLogP | 4.16 |
| TPSA | 100.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.69 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|