C33H48BN3O6 — CID 89092966
CID 89092966 (PubChem CID 89092966) has the molecular formula C33H48BN3O6 and a molecular weight of 593.57 g/mol.
| Compound Name | CID 89092966 |
|---|---|
| PubChem CID | 89092966 |
| Molecular Formula | C33H48BN3O6 |
| Molecular Weight | 593.57 g/mol |
| Exact Mass | 593.36 |
| IUPAC Name | — |
| SMILES | [B]N1CC(COC(=O)N(CCC)CCc2ccccc2)CC(N(C(=O)c2ccc(OC)c(OCCCOC)c2)C(C)C)C1 |
| InChI | InChI=1S/C33H48BN3O6/c1-6-16-35(17-15-26-11-8-7-9-12-26)33(39)43-24-27-20-29(23-36(34)22-27)37(25(2)3)32(38)28-13-14-30(41-5)31(21-28)42-19-10-18-40-4/h7-9,11-14,21,25,27,29H,6,10,15-20,22-24H2,1-5H3 |
| InChIKey | UWVSXVMKSASOQG-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 80.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.57 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|