C29H40BN3O6 — CID 89092969
CID 89092969 (PubChem CID 89092969) has the molecular formula C29H40BN3O6 and a molecular weight of 537.47 g/mol.
| Compound Name | CID 89092969 |
|---|---|
| PubChem CID | 89092969 |
| Molecular Formula | C29H40BN3O6 |
| Molecular Weight | 537.47 g/mol |
| Exact Mass | 537.30 |
| IUPAC Name | — |
| SMILES | [B]N1CC(CNC(=O)OCc2ccccc2)CC(N(C(=O)c2ccc(OC)c(OCCCOC)c2)C(C)C)C1 |
| InChI | InChI=1S/C29H40BN3O6/c1-21(2)33(28(34)24-11-12-26(37-4)27(16-24)38-14-8-13-36-3)25-15-23(18-32(30)19-25)17-31-29(35)39-20-22-9-6-5-7-10-22/h5-7,9-12,16,21,23,25H,8,13-15,17-20H2,1-4H3,(H,31,35) |
| InChIKey | WGQLJKPIXIRIIB-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 89.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|