C27H47BN2O5 — CID 143814335
ethane;3-(3-methoxypropoxy)-N-[(3R)-piperidin-3-yl]-N-propan-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (PubChem CID 143814335) has the molecular formula C27H47BN2O5 and a molecular weight of 490.49 g/mol. Its IUPAC name is ethane;3-(3-methoxypropoxy)-N-[(3R)-piperidin-3-yl]-N-propan-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide.
| Compound Name | ethane;3-(3-methoxypropoxy)-N-[(3R)-piperidin-3-yl]-N-propan-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
|---|---|
| PubChem CID | 143814335 |
| Molecular Formula | C27H47BN2O5 |
| Molecular Weight | 490.49 g/mol |
| Exact Mass | 490.36 |
| IUPAC Name | ethane;3-(3-methoxypropoxy)-N-[(3R)-piperidin-3-yl]-N-propan-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| SMILES | CC.COCCCOc1cc(C(=O)N(C(C)C)[C@@H]2CCCNC2)ccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C25H41BN2O5.C2H6/c1-18(2)28(20-10-8-13-27-17-20)23(29)19-11-12-21(22(16-19)31-15-9-14-30-7)26-32-24(3,4)25(5,6)33-26;1-2/h11-12,16,18,20,27H,8-10,13-15,17H2,1-7H3;1-2H3/t20-;/m1./s1 |
| InChIKey | NPAZPHMYPBFXBF-VEIFNGETSA-N |
| XLogP | 4.03 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.49 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|