C28H41ClN2O4 — CID 68662611
5-(3-methoxypropoxy)-2-phenyl-N-[(3R)-piperidin-3-yl]-N-propan-2-yl-4-propan-2-yloxybenzamide;hydrochloride (PubChem CID 68662611) has the molecular formula C28H41ClN2O4 and a molecular weight of 505.10 g/mol. Its IUPAC name is 5-(3-methoxypropoxy)-2-phenyl-N-[(3R)-piperidin-3-yl]-N-propan-2-yl-4-propan-2-yloxybenzamide;hydrochloride.
| Compound Name | 5-(3-methoxypropoxy)-2-phenyl-N-[(3R)-piperidin-3-yl]-N-propan-2-yl-4-propan-2-yloxybenzamide;hydrochloride |
|---|---|
| PubChem CID | 68662611 |
| Molecular Formula | C28H41ClN2O4 |
| Molecular Weight | 505.10 g/mol |
| Exact Mass | 504.28 |
| IUPAC Name | 5-(3-methoxypropoxy)-2-phenyl-N-[(3R)-piperidin-3-yl]-N-propan-2-yl-4-propan-2-yloxybenzamide;hydrochloride |
| SMILES | COCCCOc1cc(C(=O)N(C(C)C)[C@@H]2CCCNC2)c(-c2ccccc2)cc1OC(C)C.Cl |
| InChI | InChI=1S/C28H40N2O4.ClH/c1-20(2)30(23-13-9-14-29-19-23)28(31)25-18-26(33-16-10-15-32-5)27(34-21(3)4)17-24(25)22-11-7-6-8-12-22;/h6-8,11-12,17-18,20-21,23,29H,9-10,13-16,19H2,1-5H3;1H/t23-;/m1./s1 |
| InChIKey | RMHNOTQMOHXWFY-GNAFDRTKSA-N |
| XLogP | 5.58 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.10 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|