C23H34Cl2FN3O3 — CID 139582045
8-fluoro-4-(3-methoxypropoxy)-6-methyl-N-piperidin-3-yl-N-propan-2-ylquinoline-2-carboxamide;dihydrochloride (PubChem CID 139582045) has the molecular formula C23H34Cl2FN3O3 and a molecular weight of 490.45 g/mol. Its IUPAC name is 8-fluoro-4-(3-methoxypropoxy)-6-methyl-N-piperidin-3-yl-N-propan-2-ylquinoline-2-carboxamide;dihydrochloride.
| Compound Name | 8-fluoro-4-(3-methoxypropoxy)-6-methyl-N-piperidin-3-yl-N-propan-2-ylquinoline-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 139582045 |
| Molecular Formula | C23H34Cl2FN3O3 |
| Molecular Weight | 490.45 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | 8-fluoro-4-(3-methoxypropoxy)-6-methyl-N-piperidin-3-yl-N-propan-2-ylquinoline-2-carboxamide;dihydrochloride |
| SMILES | COCCCOc1cc(C(=O)N(C(C)C)C2CCCNC2)nc2c(F)cc(C)cc12.Cl.Cl |
| InChI | InChI=1S/C23H32FN3O3.2ClH/c1-15(2)27(17-7-5-8-25-14-17)23(28)20-13-21(30-10-6-9-29-4)18-11-16(3)12-19(24)22(18)26-20;;/h11-13,15,17,25H,5-10,14H2,1-4H3;2*1H |
| InChIKey | JMUSLJVWXFJKSI-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.45 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|