C22H30Cl2F3N3O2 — CID 25115977
N-[(3R)-piperidin-3-yl]-N-propan-2-yl-4-(4,4,4-trifluorobutoxy)quinoline-2-carboxamide;dihydrochloride (PubChem CID 25115977) has the molecular formula C22H30Cl2F3N3O2 and a molecular weight of 496.40 g/mol. Its IUPAC name is N-[(3R)-piperidin-3-yl]-N-propan-2-yl-4-(4,4,4-trifluorobutoxy)quinoline-2-carboxamide;dihydrochloride.
| Compound Name | N-[(3R)-piperidin-3-yl]-N-propan-2-yl-4-(4,4,4-trifluorobutoxy)quinoline-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 25115977 |
| Molecular Formula | C22H30Cl2F3N3O2 |
| Molecular Weight | 496.40 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | N-[(3R)-piperidin-3-yl]-N-propan-2-yl-4-(4,4,4-trifluorobutoxy)quinoline-2-carboxamide;dihydrochloride |
| SMILES | CC(C)N(C(=O)c1cc(OCCCC(F)(F)F)c2ccccc2n1)[C@@H]1CCCNC1.Cl.Cl |
| InChI | InChI=1S/C22H28F3N3O2.2ClH/c1-15(2)28(16-7-5-11-26-14-16)21(29)19-13-20(30-12-6-10-22(23,24)25)17-8-3-4-9-18(17)27-19;;/h3-4,8-9,13,15-16,26H,5-7,10-12,14H2,1-2H3;2*1H/t16-;;/m1../s1 |
| InChIKey | IPCPEGBKZVGFKF-GGMCWBHBSA-N |
| XLogP | 5.40 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.40 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|