C27H37N3O5 — CID 71609914
[4-(2-methoxyethoxy)-2-[[(3R)-piperidin-3-yl]-propan-2-ylcarbamoyl]quinolin-8-yl] cyclopentanecarboxylate (PubChem CID 71609914) has the molecular formula C27H37N3O5 and a molecular weight of 483.61 g/mol. Its IUPAC name is [4-(2-methoxyethoxy)-2-[[(3R)-piperidin-3-yl]-propan-2-ylcarbamoyl]quinolin-8-yl] cyclopentanecarboxylate.
| Compound Name | [4-(2-methoxyethoxy)-2-[[(3R)-piperidin-3-yl]-propan-2-ylcarbamoyl]quinolin-8-yl] cyclopentanecarboxylate |
|---|---|
| PubChem CID | 71609914 |
| Molecular Formula | C27H37N3O5 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.27 |
| IUPAC Name | [4-(2-methoxyethoxy)-2-[[(3R)-piperidin-3-yl]-propan-2-ylcarbamoyl]quinolin-8-yl] cyclopentanecarboxylate |
| SMILES | COCCOc1cc(C(=O)N(C(C)C)[C@@H]2CCCNC2)nc2c(OC(=O)C3CCCC3)cccc12 |
| InChI | InChI=1S/C27H37N3O5/c1-18(2)30(20-10-7-13-28-17-20)26(31)22-16-24(34-15-14-33-3)21-11-6-12-23(25(21)29-22)35-27(32)19-8-4-5-9-19/h6,11-12,16,18-20,28H,4-5,7-10,13-15,17H2,1-3H3/t20-/m1/s1 |
| InChIKey | ZDPIORIOQGRHLT-HXUWFJFHSA-N |
| XLogP | 3.96 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|