C28H41N3O5 — CID 154399326
8-(3,3-dimethyl-2-oxobutoxy)-4-(2-methoxyethoxy)-N-[[(3R)-piperidin-3-yl]methyl]-N-propan-2-ylquinoline-2-carboxamide (PubChem CID 154399326) has the molecular formula C28H41N3O5 and a molecular weight of 499.65 g/mol. Its IUPAC name is 8-(3,3-dimethyl-2-oxobutoxy)-4-(2-methoxyethoxy)-N-[[(3R)-piperidin-3-yl]methyl]-N-propan-2-ylquinoline-2-carboxamide.
| Compound Name | 8-(3,3-dimethyl-2-oxobutoxy)-4-(2-methoxyethoxy)-N-[[(3R)-piperidin-3-yl]methyl]-N-propan-2-ylquinoline-2-carboxamide |
|---|---|
| PubChem CID | 154399326 |
| Molecular Formula | C28H41N3O5 |
| Molecular Weight | 499.65 g/mol |
| Exact Mass | 499.30 |
| IUPAC Name | 8-(3,3-dimethyl-2-oxobutoxy)-4-(2-methoxyethoxy)-N-[[(3R)-piperidin-3-yl]methyl]-N-propan-2-ylquinoline-2-carboxamide |
| SMILES | COCCOc1cc(C(=O)N(C[C@@H]2CCCNC2)C(C)C)nc2c(OCC(=O)C(C)(C)C)cccc12 |
| InChI | InChI=1S/C28H41N3O5/c1-19(2)31(17-20-9-8-12-29-16-20)27(33)22-15-24(35-14-13-34-6)21-10-7-11-23(26(21)30-22)36-18-25(32)28(3,4)5/h7,10-11,15,19-20,29H,8-9,12-14,16-18H2,1-6H3/t20-/m1/s1 |
| InChIKey | MVBUPXVUYZRRSP-HXUWFJFHSA-N |
| XLogP | 4.10 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.65 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|