C28H47N3O3 — CID 143750165
1-(4-methoxybutyl)-N-[(3R)-piperidin-3-yl]-N-propan-2-yl-3-propoxyindole-2-carboxamide;propane (PubChem CID 143750165) has the molecular formula C28H47N3O3 and a molecular weight of 473.70 g/mol. Its IUPAC name is 1-(4-methoxybutyl)-N-[(3R)-piperidin-3-yl]-N-propan-2-yl-3-propoxyindole-2-carboxamide;propane.
| Compound Name | 1-(4-methoxybutyl)-N-[(3R)-piperidin-3-yl]-N-propan-2-yl-3-propoxyindole-2-carboxamide;propane |
|---|---|
| PubChem CID | 143750165 |
| Molecular Formula | C28H47N3O3 |
| Molecular Weight | 473.70 g/mol |
| Exact Mass | 473.36 |
| IUPAC Name | 1-(4-methoxybutyl)-N-[(3R)-piperidin-3-yl]-N-propan-2-yl-3-propoxyindole-2-carboxamide;propane |
| SMILES | CCC.CCCOc1c(C(=O)N(C(C)C)[C@@H]2CCCNC2)n(CCCCOC)c2ccccc12 |
| InChI | InChI=1S/C25H39N3O3.C3H8/c1-5-16-31-24-21-12-6-7-13-22(21)27(15-8-9-17-30-4)23(24)25(29)28(19(2)3)20-11-10-14-26-18-20;1-3-2/h6-7,12-13,19-20,26H,5,8-11,14-18H2,1-4H3;3H2,1-2H3/t20-;/m1./s1 |
| InChIKey | WFBHXNVPKGHADA-VEIFNGETSA-N |
| XLogP | 5.88 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.70 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|