C36H29F3N2O6 — CID 118340049
[1-(3-naphthalen-1-yloxypropyl)-5-phenylmethoxy-3-[3-(trifluoromethoxy)anilino]indol-2-yl] hydrogen carbonate (PubChem CID 118340049) has the molecular formula C36H29F3N2O6 and a molecular weight of 642.63 g/mol. Its IUPAC name is [1-(3-naphthalen-1-yloxypropyl)-5-phenylmethoxy-3-[3-(trifluoromethoxy)anilino]indol-2-yl] hydrogen carbonate.
| Compound Name | [1-(3-naphthalen-1-yloxypropyl)-5-phenylmethoxy-3-[3-(trifluoromethoxy)anilino]indol-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 118340049 |
| Molecular Formula | C36H29F3N2O6 |
| Molecular Weight | 642.63 g/mol |
| Exact Mass | 642.20 |
| IUPAC Name | [1-(3-naphthalen-1-yloxypropyl)-5-phenylmethoxy-3-[3-(trifluoromethoxy)anilino]indol-2-yl] hydrogen carbonate |
| SMILES | O=C(O)Oc1c(Nc2cccc(OC(F)(F)F)c2)c2cc(OCc3ccccc3)ccc2n1CCCOc1cccc2ccccc12 |
| InChI | InChI=1S/C36H29F3N2O6/c37-36(38,39)47-28-14-7-13-26(21-28)40-33-30-22-27(45-23-24-9-2-1-3-10-24)17-18-31(30)41(34(33)46-35(42)43)19-8-20-44-32-16-6-12-25-11-4-5-15-29(25)32/h1-7,9-18,21-22,40H,8,19-20,23H2,(H,42,43) |
| InChIKey | AGCMVODGAKQXPT-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 91.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.63 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|