C30H28N2O6S — CID 118340081
[3-[3-(dimethylsulfamoyl)phenyl]-1-(3-naphthalen-1-yloxypropyl)indol-2-yl] hydrogen carbonate (PubChem CID 118340081) has the molecular formula C30H28N2O6S and a molecular weight of 544.63 g/mol. Its IUPAC name is [3-[3-(dimethylsulfamoyl)phenyl]-1-(3-naphthalen-1-yloxypropyl)indol-2-yl] hydrogen carbonate.
| Compound Name | [3-[3-(dimethylsulfamoyl)phenyl]-1-(3-naphthalen-1-yloxypropyl)indol-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 118340081 |
| Molecular Formula | C30H28N2O6S |
| Molecular Weight | 544.63 g/mol |
| Exact Mass | 544.17 |
| IUPAC Name | [3-[3-(dimethylsulfamoyl)phenyl]-1-(3-naphthalen-1-yloxypropyl)indol-2-yl] hydrogen carbonate |
| SMILES | CN(C)S(=O)(=O)c1cccc(-c2c(OC(=O)O)n(CCCOc3cccc4ccccc34)c3ccccc23)c1 |
| InChI | InChI=1S/C30H28N2O6S/c1-31(2)39(35,36)23-13-7-12-22(20-23)28-25-15-5-6-16-26(25)32(29(28)38-30(33)34)18-9-19-37-27-17-8-11-21-10-3-4-14-24(21)27/h3-8,10-17,20H,9,18-19H2,1-2H3,(H,33,34) |
| InChIKey | HSLYGFBIWIMXEY-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.63 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|