C30H27NO4 — CID 118340034
[3-(2,6-dimethylphenyl)-1-(3-naphthalen-1-yloxypropyl)indol-2-yl] hydrogen carbonate (PubChem CID 118340034) has the molecular formula C30H27NO4 and a molecular weight of 465.55 g/mol. Its IUPAC name is [3-(2,6-dimethylphenyl)-1-(3-naphthalen-1-yloxypropyl)indol-2-yl] hydrogen carbonate.
| Compound Name | [3-(2,6-dimethylphenyl)-1-(3-naphthalen-1-yloxypropyl)indol-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 118340034 |
| Molecular Formula | C30H27NO4 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | [3-(2,6-dimethylphenyl)-1-(3-naphthalen-1-yloxypropyl)indol-2-yl] hydrogen carbonate |
| SMILES | Cc1cccc(C)c1-c1c(OC(=O)O)n(CCCOc2cccc3ccccc23)c2ccccc12 |
| InChI | InChI=1S/C30H27NO4/c1-20-10-7-11-21(2)27(20)28-24-15-5-6-16-25(24)31(29(28)35-30(32)33)18-9-19-34-26-17-8-13-22-12-3-4-14-23(22)26/h3-8,10-17H,9,18-19H2,1-2H3,(H,32,33) |
| InChIKey | DGSYZIUSMUNEJO-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|