C21H17NO4 — CID 4005781
1-(3-naphthalen-1-yloxypropyl)-3,1-benzoxazine-2,4-dione (PubChem CID 4005781) has the molecular formula C21H17NO4 and a molecular weight of 347.37 g/mol. Its IUPAC name is 1-(3-naphthalen-1-yloxypropyl)-3,1-benzoxazine-2,4-dione.
| Compound Name | 1-(3-naphthalen-1-yloxypropyl)-3,1-benzoxazine-2,4-dione |
|---|---|
| PubChem CID | 4005781 |
| Molecular Formula | C21H17NO4 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 1-(3-naphthalen-1-yloxypropyl)-3,1-benzoxazine-2,4-dione |
| SMILES | O=c1oc(=O)n(CCCOc2cccc3ccccc23)c2ccccc12 |
| InChI | InChI=1S/C21H17NO4/c23-20-17-10-3-4-11-18(17)22(21(24)26-20)13-6-14-25-19-12-5-8-15-7-1-2-9-16(15)19/h1-5,7-12H,6,13-14H2 |
| InChIKey | KWBSQKYCSHIQLQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 61.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|