C20H21NO4 — CID 18802468
1-[3-(2,5-dimethylphenoxy)propyl]-6-methyl-3,1-benzoxazine-2,4-dione (PubChem CID 18802468) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is 1-[3-(2,5-dimethylphenoxy)propyl]-6-methyl-3,1-benzoxazine-2,4-dione.
| Compound Name | 1-[3-(2,5-dimethylphenoxy)propyl]-6-methyl-3,1-benzoxazine-2,4-dione |
|---|---|
| PubChem CID | 18802468 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 1-[3-(2,5-dimethylphenoxy)propyl]-6-methyl-3,1-benzoxazine-2,4-dione |
| SMILES | Cc1ccc(C)c(OCCCn2c(=O)oc(=O)c3cc(C)ccc32)c1 |
| InChI | InChI=1S/C20H21NO4/c1-13-6-8-17-16(11-13)19(22)25-20(23)21(17)9-4-10-24-18-12-14(2)5-7-15(18)3/h5-8,11-12H,4,9-10H2,1-3H3 |
| InChIKey | DRTMEOBGUCUONB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 61.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|