C14H11NO3S — CID 11687680
1-(2-thiophen-2-ylethyl)-3,1-benzoxazine-2,4-dione (PubChem CID 11687680) has the molecular formula C14H11NO3S and a molecular weight of 273.31 g/mol. Its IUPAC name is 1-(2-thiophen-2-ylethyl)-3,1-benzoxazine-2,4-dione.
| Compound Name | 1-(2-thiophen-2-ylethyl)-3,1-benzoxazine-2,4-dione |
|---|---|
| PubChem CID | 11687680 |
| Molecular Formula | C14H11NO3S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | 1-(2-thiophen-2-ylethyl)-3,1-benzoxazine-2,4-dione |
| SMILES | O=c1oc(=O)n(CCc2cccs2)c2ccccc12 |
| InChI | InChI=1S/C14H11NO3S/c16-13-11-5-1-2-6-12(11)15(14(17)18-13)8-7-10-4-3-9-19-10/h1-6,9H,7-8H2 |
| InChIKey | BMTUZAYGGBQCSP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 52.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |