C13H15NO4 — CID 11586859
1-(3-methoxybutyl)-3,1-benzoxazine-2,4-dione (PubChem CID 11586859) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is 1-(3-methoxybutyl)-3,1-benzoxazine-2,4-dione.
| Compound Name | 1-(3-methoxybutyl)-3,1-benzoxazine-2,4-dione |
|---|---|
| PubChem CID | 11586859 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 1-(3-methoxybutyl)-3,1-benzoxazine-2,4-dione |
| SMILES | COC(C)CCn1c(=O)oc(=O)c2ccccc21 |
| InChI | InChI=1S/C13H15NO4/c1-9(17-2)7-8-14-11-6-4-3-5-10(11)12(15)18-13(14)16/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | CKRZWMFKHZJGRA-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 61.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |