C15H10INO3 — CID 65489350
1-[(4-iodophenyl)methyl]-3,1-benzoxazine-2,4-dione (PubChem CID 65489350) has the molecular formula C15H10INO3 and a molecular weight of 379.15 g/mol. Its IUPAC name is 1-[(4-iodophenyl)methyl]-3,1-benzoxazine-2,4-dione.
| Compound Name | 1-[(4-iodophenyl)methyl]-3,1-benzoxazine-2,4-dione |
|---|---|
| PubChem CID | 65489350 |
| Molecular Formula | C15H10INO3 |
| Molecular Weight | 379.15 g/mol |
| Exact Mass | 378.97 |
| IUPAC Name | 1-[(4-iodophenyl)methyl]-3,1-benzoxazine-2,4-dione |
| SMILES | O=c1oc(=O)n(Cc2ccc(I)cc2)c2ccccc12 |
| InChI | InChI=1S/C15H10INO3/c16-11-7-5-10(6-8-11)9-17-13-4-2-1-3-12(13)14(18)20-15(17)19/h1-8H,9H2 |
| InChIKey | ILXODHQMRBUITM-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 52.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.15 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|