C16H10N2O3 — CID 141139474
3-[(2,4-dioxo-3,1-benzoxazin-1-yl)methyl]benzonitrile (PubChem CID 141139474) has the molecular formula C16H10N2O3 and a molecular weight of 278.27 g/mol. Its IUPAC name is 3-[(2,4-dioxo-3,1-benzoxazin-1-yl)methyl]benzonitrile.
| Compound Name | 3-[(2,4-dioxo-3,1-benzoxazin-1-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 141139474 |
| Molecular Formula | C16H10N2O3 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 3-[(2,4-dioxo-3,1-benzoxazin-1-yl)methyl]benzonitrile |
| SMILES | N#Cc1cccc(Cn2c(=O)oc(=O)c3ccccc32)c1 |
| InChI | InChI=1S/C16H10N2O3/c17-9-11-4-3-5-12(8-11)10-18-14-7-2-1-6-13(14)15(19)21-16(18)20/h1-8H,10H2 |
| InChIKey | CIUMYYWWENEMAW-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 76.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |