C24H16FNO6 — CID 159366449
1-[(4-fluorophenyl)methyl]-3,1-benzoxazine-2,4-dione;4H-isochromene-1,3-dione (PubChem CID 159366449) has the molecular formula C24H16FNO6 and a molecular weight of 433.39 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-3,1-benzoxazine-2,4-dione;4H-isochromene-1,3-dione.
| Compound Name | 1-[(4-fluorophenyl)methyl]-3,1-benzoxazine-2,4-dione;4H-isochromene-1,3-dione |
|---|---|
| PubChem CID | 159366449 |
| Molecular Formula | C24H16FNO6 |
| Molecular Weight | 433.39 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-3,1-benzoxazine-2,4-dione;4H-isochromene-1,3-dione |
| SMILES | O=C1Cc2ccccc2C(=O)O1.O=c1oc(=O)n(Cc2ccc(F)cc2)c2ccccc12 |
| InChI | InChI=1S/C15H10FNO3.C9H6O3/c16-11-7-5-10(6-8-11)9-17-13-4-2-1-3-12(13)14(18)20-15(17)19;10-8-5-6-3-1-2-4-7(6)9(11)12-8/h1-8H,9H2;1-4H,5H2 |
| InChIKey | LJEOOZNZFLJJMB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 95.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|