C29H23F3N2O5 — CID 118339959
[1-(3-naphthalen-1-yloxypropyl)-3-[3-(trifluoromethoxy)anilino]indol-2-yl] hydrogen carbonate (PubChem CID 118339959) has the molecular formula C29H23F3N2O5 and a molecular weight of 536.51 g/mol. Its IUPAC name is [1-(3-naphthalen-1-yloxypropyl)-3-[3-(trifluoromethoxy)anilino]indol-2-yl] hydrogen carbonate.
| Compound Name | [1-(3-naphthalen-1-yloxypropyl)-3-[3-(trifluoromethoxy)anilino]indol-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 118339959 |
| Molecular Formula | C29H23F3N2O5 |
| Molecular Weight | 536.51 g/mol |
| Exact Mass | 536.16 |
| IUPAC Name | [1-(3-naphthalen-1-yloxypropyl)-3-[3-(trifluoromethoxy)anilino]indol-2-yl] hydrogen carbonate |
| SMILES | O=C(O)Oc1c(Nc2cccc(OC(F)(F)F)c2)c2ccccc2n1CCCOc1cccc2ccccc12 |
| InChI | InChI=1S/C29H23F3N2O5/c30-29(31,32)39-21-11-6-10-20(18-21)33-26-23-13-3-4-14-24(23)34(27(26)38-28(35)36)16-7-17-37-25-15-5-9-19-8-1-2-12-22(19)25/h1-6,8-15,18,33H,7,16-17H2,(H,35,36) |
| InChIKey | KJOMENREJCTEQI-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.51 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|