C30H27NO6 — CID 118340020
[3-(3,4-dimethoxyphenyl)-1-(3-naphthalen-1-yloxypropyl)indol-2-yl] hydrogen carbonate (PubChem CID 118340020) has the molecular formula C30H27NO6 and a molecular weight of 497.55 g/mol. Its IUPAC name is [3-(3,4-dimethoxyphenyl)-1-(3-naphthalen-1-yloxypropyl)indol-2-yl] hydrogen carbonate.
| Compound Name | [3-(3,4-dimethoxyphenyl)-1-(3-naphthalen-1-yloxypropyl)indol-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 118340020 |
| Molecular Formula | C30H27NO6 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | [3-(3,4-dimethoxyphenyl)-1-(3-naphthalen-1-yloxypropyl)indol-2-yl] hydrogen carbonate |
| SMILES | COc1ccc(-c2c(OC(=O)O)n(CCCOc3cccc4ccccc34)c3ccccc23)cc1OC |
| InChI | InChI=1S/C30H27NO6/c1-34-26-16-15-21(19-27(26)35-2)28-23-12-5-6-13-24(23)31(29(28)37-30(32)33)17-8-18-36-25-14-7-10-20-9-3-4-11-22(20)25/h3-7,9-16,19H,8,17-18H2,1-2H3,(H,32,33) |
| InChIKey | SCRFHRBIYDAIIN-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|