C30H34N2O5 — CID 175730233
1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylic acid (PubChem CID 175730233) has the molecular formula C30H34N2O5 and a molecular weight of 502.61 g/mol. Its IUPAC name is 1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylic acid.
| Compound Name | 1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylic acid |
|---|---|
| PubChem CID | 175730233 |
| Molecular Formula | C30H34N2O5 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | 1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)NCCCn1c(C(=O)O)c(CCCOc2cccc3ccccc23)c2ccccc21 |
| InChI | InChI=1S/C30H34N2O5/c1-30(2,3)37-29(35)31-18-10-19-32-25-16-7-6-14-23(25)24(27(32)28(33)34)15-9-20-36-26-17-8-12-21-11-4-5-13-22(21)26/h4-8,11-14,16-17H,9-10,15,18-20H2,1-3H3,(H,31,35)(H,33,34) |
| InChIKey | CMMHYQKGDAWUFM-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|