C24H27NO3 — CID 121230742
tert-butyl N-(3-naphthalen-1-yloxy-1-phenylpropyl)carbamate (PubChem CID 121230742) has the molecular formula C24H27NO3 and a molecular weight of 377.48 g/mol. Its IUPAC name is tert-butyl N-(3-naphthalen-1-yloxy-1-phenylpropyl)carbamate.
| Compound Name | tert-butyl N-(3-naphthalen-1-yloxy-1-phenylpropyl)carbamate |
|---|---|
| PubChem CID | 121230742 |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | tert-butyl N-(3-naphthalen-1-yloxy-1-phenylpropyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CCOc1cccc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C24H27NO3/c1-24(2,3)28-23(26)25-21(19-11-5-4-6-12-19)16-17-27-22-15-9-13-18-10-7-8-14-20(18)22/h4-15,21H,16-17H2,1-3H3,(H,25,26) |
| InChIKey | DYLNOWNCGBJNMC-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |