C36H41ClN4O5 — CID 166722026
6-chloro-1-ethyl-7-[3-ethyl-5-(hydroxymethyl)-1-(2-morpholin-4-ylethyl)pyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylic acid (PubChem CID 166722026) has the molecular formula C36H41ClN4O5 and a molecular weight of 645.20 g/mol. Its IUPAC name is 6-chloro-1-ethyl-7-[3-ethyl-5-(hydroxymethyl)-1-(2-morpholin-4-ylethyl)pyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylic acid.
| Compound Name | 6-chloro-1-ethyl-7-[3-ethyl-5-(hydroxymethyl)-1-(2-morpholin-4-ylethyl)pyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylic acid |
|---|---|
| PubChem CID | 166722026 |
| Molecular Formula | C36H41ClN4O5 |
| Molecular Weight | 645.20 g/mol |
| Exact Mass | 644.28 |
| IUPAC Name | 6-chloro-1-ethyl-7-[3-ethyl-5-(hydroxymethyl)-1-(2-morpholin-4-ylethyl)pyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)indole-2-carboxylic acid |
| SMILES | CCc1nn(CCN2CCOCC2)c(CO)c1-c1c(Cl)ccc2c(CCCOc3cccc4ccccc34)c(C(=O)O)n(CC)c12 |
| InChI | InChI=1S/C36H41ClN4O5/c1-3-29-33(30(23-42)41(38-29)17-16-39-18-21-45-22-19-39)32-28(37)15-14-27-26(35(36(43)44)40(4-2)34(27)32)12-8-20-46-31-13-7-10-24-9-5-6-11-25(24)31/h5-7,9-11,13-15,42H,3-4,8,12,16-23H2,1-2H3,(H,43,44) |
| InChIKey | XHYPZKGVQXDXGL-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.20 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|