C35H38ClN3O4 — CID 166724711
ethyl 19-chloro-3,4,11-trimethyl-15-(3-naphthalen-1-yloxypropyl)-8-oxa-4,5,13-triazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaene-14-carboxylate (PubChem CID 166724711) has the molecular formula C35H38ClN3O4 and a molecular weight of 600.16 g/mol. Its IUPAC name is ethyl 19-chloro-3,4,11-trimethyl-15-(3-naphthalen-1-yloxypropyl)-8-oxa-4,5,13-triazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaene-14-carboxylate.
| Compound Name | ethyl 19-chloro-3,4,11-trimethyl-15-(3-naphthalen-1-yloxypropyl)-8-oxa-4,5,13-triazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaene-14-carboxylate |
|---|---|
| PubChem CID | 166724711 |
| Molecular Formula | C35H38ClN3O4 |
| Molecular Weight | 600.16 g/mol |
| Exact Mass | 599.26 |
| IUPAC Name | ethyl 19-chloro-3,4,11-trimethyl-15-(3-naphthalen-1-yloxypropyl)-8-oxa-4,5,13-triazatetracyclo[11.6.1.02,6.016,20]icosa-1(19),2,5,14,16(20),17-hexaene-14-carboxylate |
| SMILES | CCOC(=O)c1c(CCCOc2cccc3ccccc23)c2ccc(Cl)c3c2n1CC(C)CCOCc1nn(C)c(C)c1-3 |
| InChI | InChI=1S/C35H38ClN3O4/c1-5-42-35(40)34-26(13-9-18-43-30-14-8-11-24-10-6-7-12-25(24)30)27-15-16-28(36)32-31-23(3)38(4)37-29(31)21-41-19-17-22(2)20-39(34)33(27)32/h6-8,10-12,14-16,22H,5,9,13,17-21H2,1-4H3 |
| InChIKey | ZJMRBHBTTURGJI-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 67.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.16 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|