C33H34ClN3O4 — CID 142591851
ethyl 6-chloro-7-[3-[cyclopropyl(hydroxy)methyl]-1,5-dimethylpyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylate (PubChem CID 142591851) has the molecular formula C33H34ClN3O4 and a molecular weight of 572.11 g/mol. Its IUPAC name is ethyl 6-chloro-7-[3-[cyclopropyl(hydroxy)methyl]-1,5-dimethylpyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylate.
| Compound Name | ethyl 6-chloro-7-[3-[cyclopropyl(hydroxy)methyl]-1,5-dimethylpyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 142591851 |
| Molecular Formula | C33H34ClN3O4 |
| Molecular Weight | 572.11 g/mol |
| Exact Mass | 571.22 |
| IUPAC Name | ethyl 6-chloro-7-[3-[cyclopropyl(hydroxy)methyl]-1,5-dimethylpyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2c(-c3c(C(O)C4CC4)nn(C)c3C)c(Cl)ccc2c1CCCOc1cccc2ccccc12 |
| InChI | InChI=1S/C33H34ClN3O4/c1-4-40-33(39)30-23(12-8-18-41-26-13-7-10-20-9-5-6-11-22(20)26)24-16-17-25(34)28(29(24)35-30)27-19(2)37(3)36-31(27)32(38)21-14-15-21/h5-7,9-11,13,16-17,21,32,35,38H,4,8,12,14-15,18H2,1-3H3 |
| InChIKey | ONZHBUYFLKVDDM-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.11 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|