C35H43ClN4O4 — CID 158033845
ethyl 6-chloro-7-[3-[5-hydroxypentyl(methyl)amino]-5-methyl-1H-pyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylate;methane (PubChem CID 158033845) has the molecular formula C35H43ClN4O4 and a molecular weight of 619.21 g/mol. Its IUPAC name is ethyl 6-chloro-7-[3-[5-hydroxypentyl(methyl)amino]-5-methyl-1H-pyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylate;methane.
| Compound Name | ethyl 6-chloro-7-[3-[5-hydroxypentyl(methyl)amino]-5-methyl-1H-pyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylate;methane |
|---|---|
| PubChem CID | 158033845 |
| Molecular Formula | C35H43ClN4O4 |
| Molecular Weight | 619.21 g/mol |
| Exact Mass | 618.30 |
| IUPAC Name | ethyl 6-chloro-7-[3-[5-hydroxypentyl(methyl)amino]-5-methyl-1H-pyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylate;methane |
| SMILES | C.CCOC(=O)c1[nH]c2c(-c3c(N(C)CCCCCO)n[nH]c3C)c(Cl)ccc2c1CCCOc1cccc2ccccc12 |
| InChI | InChI=1S/C34H39ClN4O4.CH4/c1-4-42-34(41)32-25(15-11-21-43-28-16-10-13-23-12-6-7-14-24(23)28)26-17-18-27(35)30(31(26)36-32)29-22(2)37-38-33(29)39(3)19-8-5-9-20-40;/h6-7,10,12-14,16-18,36,40H,4-5,8-9,11,15,19-21H2,1-3H3,(H,37,38);1H4 |
| InChIKey | FHMTYCSDHWSLAS-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 103.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.21 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|