C32H29BrClNO4S — CID 155775961
ethyl 7-bromo-6-chloro-3-[3-[3-[(4-methoxyphenyl)methylsulfanyl]naphthalen-1-yl]oxypropyl]-1H-indole-2-carboxylate (PubChem CID 155775961) has the molecular formula C32H29BrClNO4S and a molecular weight of 639.01 g/mol. Its IUPAC name is ethyl 7-bromo-6-chloro-3-[3-[3-[(4-methoxyphenyl)methylsulfanyl]naphthalen-1-yl]oxypropyl]-1H-indole-2-carboxylate.
| Compound Name | ethyl 7-bromo-6-chloro-3-[3-[3-[(4-methoxyphenyl)methylsulfanyl]naphthalen-1-yl]oxypropyl]-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 155775961 |
| Molecular Formula | C32H29BrClNO4S |
| Molecular Weight | 639.01 g/mol |
| Exact Mass | 637.07 |
| IUPAC Name | ethyl 7-bromo-6-chloro-3-[3-[3-[(4-methoxyphenyl)methylsulfanyl]naphthalen-1-yl]oxypropyl]-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2c(Br)c(Cl)ccc2c1CCCOc1cc(SCc2ccc(OC)cc2)cc2ccccc12 |
| InChI | InChI=1S/C32H29BrClNO4S/c1-3-38-32(36)31-25(26-14-15-27(34)29(33)30(26)35-31)9-6-16-39-28-18-23(17-21-7-4-5-8-24(21)28)40-19-20-10-12-22(37-2)13-11-20/h4-5,7-8,10-15,17-18,35H,3,6,9,16,19H2,1-2H3 |
| InChIKey | PIJSZQXCZGLRCW-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 60.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.01 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|