C32H31ClF3N3O4 — CID 175793274
ethyl 6-chloro-7-[5-ethyl-1-methyl-3-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]pyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylate (PubChem CID 175793274) has the molecular formula C32H31ClF3N3O4 and a molecular weight of 614.06 g/mol. Its IUPAC name is ethyl 6-chloro-7-[5-ethyl-1-methyl-3-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]pyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylate.
| Compound Name | ethyl 6-chloro-7-[5-ethyl-1-methyl-3-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]pyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 175793274 |
| Molecular Formula | C32H31ClF3N3O4 |
| Molecular Weight | 614.06 g/mol |
| Exact Mass | 613.20 |
| IUPAC Name | ethyl 6-chloro-7-[5-ethyl-1-methyl-3-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]pyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2c(-c3c([C@@H](O)C(F)(F)F)nn(C)c3CC)c(Cl)ccc2c1CCCOc1cccc2ccccc12 |
| InChI | InChI=1S/C32H31ClF3N3O4/c1-4-23-26(29(38-39(23)3)30(40)32(34,35)36)25-22(33)16-15-21-20(28(37-27(21)25)31(41)42-5-2)13-9-17-43-24-14-8-11-18-10-6-7-12-19(18)24/h6-8,10-12,14-16,30,37,40H,4-5,9,13,17H2,1-3H3/t30-/m1/s1 |
| InChIKey | PYCHSTJAUXPWJA-SSEXGKCCSA-N |
| XLogP | 7.72 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.06 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|