C34H35ClFN3O4 — CID 142591813
ethyl 6-chloro-7-[3-[cyclopropyl(hydroxy)methyl]-5-ethyl-1-methylpyrazol-4-yl]-3-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-1H-indole-2-carboxylate (PubChem CID 142591813) has the molecular formula C34H35ClFN3O4 and a molecular weight of 604.12 g/mol. Its IUPAC name is ethyl 6-chloro-7-[3-[cyclopropyl(hydroxy)methyl]-5-ethyl-1-methylpyrazol-4-yl]-3-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-1H-indole-2-carboxylate.
| Compound Name | ethyl 6-chloro-7-[3-[cyclopropyl(hydroxy)methyl]-5-ethyl-1-methylpyrazol-4-yl]-3-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 142591813 |
| Molecular Formula | C34H35ClFN3O4 |
| Molecular Weight | 604.12 g/mol |
| Exact Mass | 603.23 |
| IUPAC Name | ethyl 6-chloro-7-[3-[cyclopropyl(hydroxy)methyl]-5-ethyl-1-methylpyrazol-4-yl]-3-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2c(-c3c(C(O)C4CC4)nn(C)c3CC)c(Cl)ccc2c1CCCOc1cccc2cc(F)ccc12 |
| InChI | InChI=1S/C34H35ClFN3O4/c1-4-26-29(32(38-39(26)3)33(40)19-11-12-19)28-25(35)16-15-24-23(31(37-30(24)28)34(41)42-5-2)9-7-17-43-27-10-6-8-20-18-21(36)13-14-22(20)27/h6,8,10,13-16,18-19,33,37,40H,4-5,7,9,11-12,17H2,1-3H3 |
| InChIKey | RTETWYXZBYTTIO-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.12 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|