C36H39Cl2FN4O5S — CID 158712386
ethyl 6-chloro-7-[5-[[3-chloropropylsulfonyl(cyclopropyl)amino]methyl]-3-ethyl-1H-pyrazol-4-yl]-3-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-1H-indole-2-carboxylate (PubChem CID 158712386) has the molecular formula C36H39Cl2FN4O5S and a molecular weight of 729.70 g/mol. Its IUPAC name is ethyl 6-chloro-7-[5-[[3-chloropropylsulfonyl(cyclopropyl)amino]methyl]-3-ethyl-1H-pyrazol-4-yl]-3-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-1H-indole-2-carboxylate.
| Compound Name | ethyl 6-chloro-7-[5-[[3-chloropropylsulfonyl(cyclopropyl)amino]methyl]-3-ethyl-1H-pyrazol-4-yl]-3-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 158712386 |
| Molecular Formula | C36H39Cl2FN4O5S |
| Molecular Weight | 729.70 g/mol |
| Exact Mass | 728.20 |
| IUPAC Name | ethyl 6-chloro-7-[5-[[3-chloropropylsulfonyl(cyclopropyl)amino]methyl]-3-ethyl-1H-pyrazol-4-yl]-3-[3-(6-fluoronaphthalen-1-yl)oxypropyl]-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2c(-c3c(CC)n[nH]c3CN(C3CC3)S(=O)(=O)CCCCl)c(Cl)ccc2c1CCCOc1cccc2cc(F)ccc12 |
| InChI | InChI=1S/C36H39Cl2FN4O5S/c1-3-29-33(30(42-41-29)21-43(24-12-13-24)49(45,46)19-7-17-37)32-28(38)16-15-27-26(35(40-34(27)32)36(44)47-4-2)9-6-18-48-31-10-5-8-22-20-23(39)11-14-25(22)31/h5,8,10-11,14-16,20,24,40H,3-4,6-7,9,12-13,17-19,21H2,1-2H3,(H,41,42) |
| InChIKey | HXMULFPNJRSYIO-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 117.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.70 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|