C41H52ClN5O6S — CID 142591671
ethyl 7-[3-[[3-chloropropylsulfonyl(3-morpholin-4-ylpropyl)amino]methyl]-5-ethyl-1-methylpyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylate (PubChem CID 142591671) has the molecular formula C41H52ClN5O6S and a molecular weight of 778.42 g/mol. Its IUPAC name is ethyl 7-[3-[[3-chloropropylsulfonyl(3-morpholin-4-ylpropyl)amino]methyl]-5-ethyl-1-methylpyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylate.
| Compound Name | ethyl 7-[3-[[3-chloropropylsulfonyl(3-morpholin-4-ylpropyl)amino]methyl]-5-ethyl-1-methylpyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 142591671 |
| Molecular Formula | C41H52ClN5O6S |
| Molecular Weight | 778.42 g/mol |
| Exact Mass | 777.33 |
| IUPAC Name | ethyl 7-[3-[[3-chloropropylsulfonyl(3-morpholin-4-ylpropyl)amino]methyl]-5-ethyl-1-methylpyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2c(-c3c(CN(CCCN4CCOCC4)S(=O)(=O)CCCCl)nn(C)c3CC)cccc2c1CCCOc1cccc2ccccc12 |
| InChI | InChI=1S/C41H52ClN5O6S/c1-4-36-38(35(44-45(36)3)29-47(54(49,50)28-11-20-42)22-12-21-46-23-26-51-27-24-46)34-17-9-16-32-33(40(43-39(32)34)41(48)52-5-2)18-10-25-53-37-19-8-14-30-13-6-7-15-31(30)37/h6-9,13-17,19,43H,4-5,10-12,18,20-29H2,1-3H3 |
| InChIKey | XHXZPPTXJWXWNM-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 118.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.42 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|