C40H44N4O6 — CID 167681270
ethyl 7-[3-(hydroxymethyl)-5-[(4-morpholin-4-ylphenoxy)methyl]-1H-pyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylate;methane (PubChem CID 167681270) has the molecular formula C40H44N4O6 and a molecular weight of 676.81 g/mol. Its IUPAC name is ethyl 7-[3-(hydroxymethyl)-5-[(4-morpholin-4-ylphenoxy)methyl]-1H-pyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylate;methane.
| Compound Name | ethyl 7-[3-(hydroxymethyl)-5-[(4-morpholin-4-ylphenoxy)methyl]-1H-pyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylate;methane |
|---|---|
| PubChem CID | 167681270 |
| Molecular Formula | C40H44N4O6 |
| Molecular Weight | 676.81 g/mol |
| Exact Mass | 676.33 |
| IUPAC Name | ethyl 7-[3-(hydroxymethyl)-5-[(4-morpholin-4-ylphenoxy)methyl]-1H-pyrazol-4-yl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylate;methane |
| SMILES | C.CCOC(=O)c1[nH]c2c(-c3c(CO)n[nH]c3COc3ccc(N4CCOCC4)cc3)cccc2c1CCCOc1cccc2ccccc12 |
| InChI | InChI=1S/C39H40N4O6.CH4/c1-2-47-39(45)38-31(13-7-21-48-35-14-5-9-26-8-3-4-10-29(26)35)30-11-6-12-32(37(30)40-38)36-33(24-44)41-42-34(36)25-49-28-17-15-27(16-18-28)43-19-22-46-23-20-43;/h3-6,8-12,14-18,40,44H,2,7,13,19-25H2,1H3,(H,41,42);1H4 |
| InChIKey | VOSHQAKHKDQWGV-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 121.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.81 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|