C31H38BNO5 — CID 174004022
[2-ethoxycarbonyl-3-(3-naphthalen-1-yloxypropyl)-1H-indol-7-yl]-(2,3,3-trimethylbutan-2-yloxy)borinic acid (PubChem CID 174004022) has the molecular formula C31H38BNO5 and a molecular weight of 515.46 g/mol. Its IUPAC name is [2-ethoxycarbonyl-3-(3-naphthalen-1-yloxypropyl)-1H-indol-7-yl]-(2,3,3-trimethylbutan-2-yloxy)borinic acid.
| Compound Name | [2-ethoxycarbonyl-3-(3-naphthalen-1-yloxypropyl)-1H-indol-7-yl]-(2,3,3-trimethylbutan-2-yloxy)borinic acid |
|---|---|
| PubChem CID | 174004022 |
| Molecular Formula | C31H38BNO5 |
| Molecular Weight | 515.46 g/mol |
| Exact Mass | 515.28 |
| IUPAC Name | [2-ethoxycarbonyl-3-(3-naphthalen-1-yloxypropyl)-1H-indol-7-yl]-(2,3,3-trimethylbutan-2-yloxy)borinic acid |
| SMILES | CCOC(=O)c1[nH]c2c(B(O)OC(C)(C)C(C)(C)C)cccc2c1CCCOc1cccc2ccccc12 |
| InChI | InChI=1S/C31H38BNO5/c1-7-36-29(34)28-24(17-12-20-37-26-19-10-14-21-13-8-9-15-22(21)26)23-16-11-18-25(27(23)33-28)32(35)38-31(5,6)30(2,3)4/h8-11,13-16,18-19,33,35H,7,12,17,20H2,1-6H3 |
| InChIKey | PSVGMRVHQFPDAR-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 80.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.46 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|