C30H25NO3 — CID 25022384
3-(3-naphthalen-1-yloxypropyl)-7-[(E)-2-phenylethenyl]-1H-indole-2-carboxylic acid (PubChem CID 25022384) has the molecular formula C30H25NO3 and a molecular weight of 447.53 g/mol. Its IUPAC name is 3-(3-naphthalen-1-yloxypropyl)-7-[(E)-2-phenylethenyl]-1H-indole-2-carboxylic acid.
| Compound Name | 3-(3-naphthalen-1-yloxypropyl)-7-[(E)-2-phenylethenyl]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 25022384 |
| Molecular Formula | C30H25NO3 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 3-(3-naphthalen-1-yloxypropyl)-7-[(E)-2-phenylethenyl]-1H-indole-2-carboxylic acid |
| SMILES | O=C(O)c1[nH]c2c(/C=C/c3ccccc3)cccc2c1CCCOc1cccc2ccccc12 |
| InChI | InChI=1S/C30H25NO3/c32-30(33)29-26(16-8-20-34-27-17-7-12-22-11-4-5-14-24(22)27)25-15-6-13-23(28(25)31-29)19-18-21-9-2-1-3-10-21/h1-7,9-15,17-19,31H,8,16,20H2,(H,32,33)/b19-18+ |
| InChIKey | LVNPQSLNWWQFNM-VHEBQXMUSA-N |
| XLogP | 7.20 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|