C37H30N2O6S — CID 68935319
7-[(E)-2-[3-(benzenesulfonylcarbamoyl)phenyl]ethenyl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylic acid (PubChem CID 68935319) has the molecular formula C37H30N2O6S and a molecular weight of 630.72 g/mol. Its IUPAC name is 7-[(E)-2-[3-(benzenesulfonylcarbamoyl)phenyl]ethenyl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylic acid.
| Compound Name | 7-[(E)-2-[3-(benzenesulfonylcarbamoyl)phenyl]ethenyl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 68935319 |
| Molecular Formula | C37H30N2O6S |
| Molecular Weight | 630.72 g/mol |
| Exact Mass | 630.18 |
| IUPAC Name | 7-[(E)-2-[3-(benzenesulfonylcarbamoyl)phenyl]ethenyl]-3-(3-naphthalen-1-yloxypropyl)-1H-indole-2-carboxylic acid |
| SMILES | O=C(NS(=O)(=O)c1ccccc1)c1cccc(/C=C/c2cccc3c(CCCOc4cccc5ccccc45)c(C(=O)O)[nH]c23)c1 |
| InChI | InChI=1S/C37H30N2O6S/c40-36(39-46(43,44)29-15-2-1-3-16-29)28-14-6-10-25(24-28)21-22-27-13-7-18-31-32(35(37(41)42)38-34(27)31)19-9-23-45-33-20-8-12-26-11-4-5-17-30(26)33/h1-8,10-18,20-22,24,38H,9,19,23H2,(H,39,40)(H,41,42)/b22-21+ |
| InChIKey | XWEMUPHELAYXHM-QURGRASLSA-N |
| XLogP | 7.32 |
| TPSA | 125.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.72 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|