C43H40N2O5 — CID 130274034
[7-[(E)-2-[3-(4-benzylpiperidine-1-carbonyl)phenyl]ethenyl]-3-(3-naphthalen-1-yloxypropyl)-1H-indol-2-yl] hydrogen carbonate (PubChem CID 130274034) has the molecular formula C43H40N2O5 and a molecular weight of 664.80 g/mol. Its IUPAC name is [7-[(E)-2-[3-(4-benzylpiperidine-1-carbonyl)phenyl]ethenyl]-3-(3-naphthalen-1-yloxypropyl)-1H-indol-2-yl] hydrogen carbonate.
| Compound Name | [7-[(E)-2-[3-(4-benzylpiperidine-1-carbonyl)phenyl]ethenyl]-3-(3-naphthalen-1-yloxypropyl)-1H-indol-2-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 130274034 |
| Molecular Formula | C43H40N2O5 |
| Molecular Weight | 664.80 g/mol |
| Exact Mass | 664.29 |
| IUPAC Name | [7-[(E)-2-[3-(4-benzylpiperidine-1-carbonyl)phenyl]ethenyl]-3-(3-naphthalen-1-yloxypropyl)-1H-indol-2-yl] hydrogen carbonate |
| SMILES | O=C(O)Oc1[nH]c2c(/C=C/c3cccc(C(=O)N4CCC(Cc5ccccc5)CC4)c3)cccc2c1CCCOc1cccc2ccccc12 |
| InChI | InChI=1S/C43H40N2O5/c46-42(45-25-23-32(24-26-45)28-30-10-2-1-3-11-30)35-16-6-12-31(29-35)21-22-34-15-7-18-37-38(41(44-40(34)37)50-43(47)48)19-9-27-49-39-20-8-14-33-13-4-5-17-36(33)39/h1-8,10-18,20-22,29,32,44H,9,19,23-28H2,(H,47,48)/b22-21+ |
| InChIKey | PWDDEYPYNFYBIN-QURGRASLSA-N |
| XLogP | 9.65 |
| TPSA | 91.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.80 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|