C27H27NO3 — CID 25213358
(4-benzylpiperidin-1-yl)-[4-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]phenyl]methanone (PubChem CID 25213358) has the molecular formula C27H27NO3 and a molecular weight of 413.52 g/mol. Its IUPAC name is (4-benzylpiperidin-1-yl)-[4-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]phenyl]methanone.
| Compound Name | (4-benzylpiperidin-1-yl)-[4-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]phenyl]methanone |
|---|---|
| PubChem CID | 25213358 |
| Molecular Formula | C27H27NO3 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | (4-benzylpiperidin-1-yl)-[4-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]phenyl]methanone |
| SMILES | O=C(c1ccc(/C=C/c2ccc(O)c(O)c2)cc1)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C27H27NO3/c29-25-13-10-22(19-26(25)30)7-6-20-8-11-24(12-9-20)27(31)28-16-14-23(15-17-28)18-21-4-2-1-3-5-21/h1-13,19,23,29-30H,14-18H2/b7-6+ |
| InChIKey | WXSBXNLHLOPARI-VOTSOKGWSA-N |
| XLogP | 5.36 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|