C27H24N2O8 — CID 130275274
4-[2-carboxyoxy-3-[3-(2-methyl-3-nitrophenoxy)propyl]-1H-indol-7-yl]-3-methylbenzoic acid (PubChem CID 130275274) has the molecular formula C27H24N2O8 and a molecular weight of 504.50 g/mol. Its IUPAC name is 4-[2-carboxyoxy-3-[3-(2-methyl-3-nitrophenoxy)propyl]-1H-indol-7-yl]-3-methylbenzoic acid.
| Compound Name | 4-[2-carboxyoxy-3-[3-(2-methyl-3-nitrophenoxy)propyl]-1H-indol-7-yl]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 130275274 |
| Molecular Formula | C27H24N2O8 |
| Molecular Weight | 504.50 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | 4-[2-carboxyoxy-3-[3-(2-methyl-3-nitrophenoxy)propyl]-1H-indol-7-yl]-3-methylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)ccc1-c1cccc2c(CCCOc3cccc([N+](=O)[O-])c3C)c(OC(=O)O)[nH]c12 |
| InChI | InChI=1S/C27H24N2O8/c1-15-14-17(26(30)31)11-12-18(15)19-6-3-7-20-21(25(28-24(19)20)37-27(32)33)8-5-13-36-23-10-4-9-22(16(23)2)29(34)35/h3-4,6-7,9-12,14,28H,5,8,13H2,1-2H3,(H,30,31)(H,32,33) |
| InChIKey | PVQUVVXIFQPYND-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 151.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.50 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|